C25H19Cl2N3O2 — CID 88986549
N-[4-[[4,6-dichloro-5-(2-hydroxyprop-2-enyl)pyrimidin-2-yl]methyl]phenyl]naphthalene-2-carboxamide (PubChem CID 88986549) has the molecular formula C25H19Cl2N3O2 and a molecular weight of 464.35 g/mol. Its IUPAC name is N-[4-[[4,6-dichloro-5-(2-hydroxyprop-2-enyl)pyrimidin-2-yl]methyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[[4,6-dichloro-5-(2-hydroxyprop-2-enyl)pyrimidin-2-yl]methyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 88986549 |
| Molecular Formula | C25H19Cl2N3O2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-[4-[[4,6-dichloro-5-(2-hydroxyprop-2-enyl)pyrimidin-2-yl]methyl]phenyl]naphthalene-2-carboxamide |
| SMILES | C=C(O)Cc1c(Cl)nc(Cc2ccc(NC(=O)c3ccc4ccccc4c3)cc2)nc1Cl |
| InChI | InChI=1S/C25H19Cl2N3O2/c1-15(31)12-21-23(26)29-22(30-24(21)27)13-16-6-10-20(11-7-16)28-25(32)19-9-8-17-4-2-3-5-18(17)14-19/h2-11,14,31H,1,12-13H2,(H,28,32) |
| InChIKey | ZJRGGMWOHLTOIB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|