C20H16N2O3S — CID 28687471
2-[4-(naphthalene-2-carbonylcarbamothioylamino)phenyl]acetic acid (PubChem CID 28687471) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-[4-(naphthalene-2-carbonylcarbamothioylamino)phenyl]acetic acid.
| Compound Name | 2-[4-(naphthalene-2-carbonylcarbamothioylamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 28687471 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-[4-(naphthalene-2-carbonylcarbamothioylamino)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=S)NC(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C20H16N2O3S/c23-18(24)11-13-5-9-17(10-6-13)21-20(26)22-19(25)16-8-7-14-3-1-2-4-15(14)12-16/h1-10,12H,11H2,(H,23,24)(H2,21,22,25,26) |
| InChIKey | VRKYSEDKDXTOLD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|