C25H21N3O — CID 168823701
N-(3-anilinophenyl)-4-(pyridin-4-ylmethyl)benzamide (PubChem CID 168823701) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(3-anilinophenyl)-4-(pyridin-4-ylmethyl)benzamide.
| Compound Name | N-(3-anilinophenyl)-4-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 168823701 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-(3-anilinophenyl)-4-(pyridin-4-ylmethyl)benzamide |
| SMILES | O=C(Nc1cccc(Nc2ccccc2)c1)c1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C25H21N3O/c29-25(21-11-9-19(10-12-21)17-20-13-15-26-16-14-20)28-24-8-4-7-23(18-24)27-22-5-2-1-3-6-22/h1-16,18,27H,17H2,(H,28,29) |
| InChIKey | MFIGUWKACMOFNI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |