C23H20N6O — CID 157043383
N-[3-[(2-amino-4-pyridinyl)amino]phenyl]-4-(pyridin-4-ylamino)benzamide (PubChem CID 157043383) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[3-[(2-amino-4-pyridinyl)amino]phenyl]-4-(pyridin-4-ylamino)benzamide.
| Compound Name | N-[3-[(2-amino-4-pyridinyl)amino]phenyl]-4-(pyridin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 157043383 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[3-[(2-amino-4-pyridinyl)amino]phenyl]-4-(pyridin-4-ylamino)benzamide |
| SMILES | Nc1cc(Nc2cccc(NC(=O)c3ccc(Nc4ccncc4)cc3)c2)ccn1 |
| InChI | InChI=1S/C23H20N6O/c24-22-15-21(10-13-26-22)28-19-2-1-3-20(14-19)29-23(30)16-4-6-17(7-5-16)27-18-8-11-25-12-9-18/h1-15H,(H,25,27)(H,29,30)(H3,24,26,28) |
| InChIKey | VUPYLHMKWJRWGL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |