C22H22N6O — CID 170229383
N-[3-[[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]amino]phenyl]-4-(pyridin-4-ylamino)benzamide (PubChem CID 170229383) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[3-[[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]amino]phenyl]-4-(pyridin-4-ylamino)benzamide.
| Compound Name | N-[3-[[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]amino]phenyl]-4-(pyridin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 170229383 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[3-[[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]amino]phenyl]-4-(pyridin-4-ylamino)benzamide |
| SMILES | N/C=C\C(=C/N)Nc1cccc(NC(=O)c2ccc(Nc3ccncc3)cc2)c1 |
| InChI | InChI=1S/C22H22N6O/c23-11-8-21(15-24)27-19-2-1-3-20(14-19)28-22(29)16-4-6-17(7-5-16)26-18-9-12-25-13-10-18/h1-15,27H,23-24H2,(H,25,26)(H,28,29)/b11-8-,21-15+ |
| InChIKey | SSHYVOLSELIEFM-MGFYPTAISA-N |
| XLogP | 3.76 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|