C27H18Cl4N2O2 — CID 3995292
3,5-dichloro-N-[4-[[4-[(3,5-dichlorobenzoyl)amino]phenyl]methyl]phenyl]benzamide (PubChem CID 3995292) has the molecular formula C27H18Cl4N2O2 and a molecular weight of 544.27 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-[[4-[(3,5-dichlorobenzoyl)amino]phenyl]methyl]phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-[[4-[(3,5-dichlorobenzoyl)amino]phenyl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3995292 |
| Molecular Formula | C27H18Cl4N2O2 |
| Molecular Weight | 544.27 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | 3,5-dichloro-N-[4-[[4-[(3,5-dichlorobenzoyl)amino]phenyl]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)c3cc(Cl)cc(Cl)c3)cc2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C27H18Cl4N2O2/c28-20-10-18(11-21(29)14-20)26(34)32-24-5-1-16(2-6-24)9-17-3-7-25(8-4-17)33-27(35)19-12-22(30)15-23(31)13-19/h1-8,10-15H,9H2,(H,32,34)(H,33,35) |
| InChIKey | LPFHIYYIIQFCSE-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.27 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |