C18H18Cl2N2O2 — CID 17201359
N-[4-(butan-2-ylcarbamoyl)phenyl]-3,5-dichlorobenzamide (PubChem CID 17201359) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is N-[4-(butan-2-ylcarbamoyl)phenyl]-3,5-dichlorobenzamide.
| Compound Name | N-[4-(butan-2-ylcarbamoyl)phenyl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 17201359 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[4-(butan-2-ylcarbamoyl)phenyl]-3,5-dichlorobenzamide |
| SMILES | CCC(C)NC(=O)c1ccc(NC(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-3-11(2)21-17(23)12-4-6-16(7-5-12)22-18(24)13-8-14(19)10-15(20)9-13/h4-11H,3H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | JGSMLUPJIBVXCE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |