C16H24N2O2 — CID 42427493
N-[(2R)-butan-2-yl]-4-(2,2-dimethylpropanoylamino)benzamide (PubChem CID 42427493) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-(2,2-dimethylpropanoylamino)benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-(2,2-dimethylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 42427493 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-(2,2-dimethylpropanoylamino)benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O2/c1-6-11(2)17-14(19)12-7-9-13(10-8-12)18-15(20)16(3,4)5/h7-11H,6H2,1-5H3,(H,17,19)(H,18,20)/t11-/m1/s1 |
| InChIKey | IZTIAFOLYBWBJS-LLVKDONJSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |