C20H12Cl3NO2 — CID 14146500
3,5-dichloro-N-[4-(4-chlorobenzoyl)phenyl]benzamide (PubChem CID 14146500) has the molecular formula C20H12Cl3NO2 and a molecular weight of 404.68 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(4-chlorobenzoyl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-(4-chlorobenzoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 14146500 |
| Molecular Formula | C20H12Cl3NO2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 3,5-dichloro-N-[4-(4-chlorobenzoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)c2ccc(Cl)cc2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H12Cl3NO2/c21-15-5-1-12(2-6-15)19(25)13-3-7-18(8-4-13)24-20(26)14-9-16(22)11-17(23)10-14/h1-11H,(H,24,26) |
| InChIKey | QAMNYSZLGQKNTL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |