C18H14N2O2 — CID 57399617
2-N-phenylnaphthalene-2,6-dicarboxamide (PubChem CID 57399617) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-N-phenylnaphthalene-2,6-dicarboxamide.
| Compound Name | 2-N-phenylnaphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 57399617 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-N-phenylnaphthalene-2,6-dicarboxamide |
| SMILES | NC(=O)c1ccc2cc(C(=O)Nc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C18H14N2O2/c19-17(21)14-8-6-13-11-15(9-7-12(13)10-14)18(22)20-16-4-2-1-3-5-16/h1-11H,(H2,19,21)(H,20,22) |
| InChIKey | ZQENILNLUFAMQU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |