C36H30N6O2 — CID 141400871
2-N,6-N-bis[4-(4-aminoanilino)phenyl]naphthalene-2,6-dicarboxamide (PubChem CID 141400871) has the molecular formula C36H30N6O2 and a molecular weight of 578.68 g/mol. Its IUPAC name is 2-N,6-N-bis[4-(4-aminoanilino)phenyl]naphthalene-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-(4-aminoanilino)phenyl]naphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 141400871 |
| Molecular Formula | C36H30N6O2 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 2-N,6-N-bis[4-(4-aminoanilino)phenyl]naphthalene-2,6-dicarboxamide |
| SMILES | Nc1ccc(Nc2ccc(NC(=O)c3ccc4cc(C(=O)Nc5ccc(Nc6ccc(N)cc6)cc5)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C36H30N6O2/c37-27-5-9-29(10-6-27)39-31-13-17-33(18-14-31)41-35(43)25-3-1-23-21-26(4-2-24(23)22-25)36(44)42-34-19-15-32(16-20-34)40-30-11-7-28(38)8-12-30/h1-22,39-40H,37-38H2,(H,41,43)(H,42,44) |
| InChIKey | JAFAUPBTGCGEDH-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|