C17H17N7O — CID 59457974
N-(4-aminophenyl)-4-[(2,6-diaminopyrimidin-4-yl)amino]benzamide (PubChem CID 59457974) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-[(2,6-diaminopyrimidin-4-yl)amino]benzamide.
| Compound Name | N-(4-aminophenyl)-4-[(2,6-diaminopyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 59457974 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-(4-aminophenyl)-4-[(2,6-diaminopyrimidin-4-yl)amino]benzamide |
| SMILES | Nc1ccc(NC(=O)c2ccc(Nc3cc(N)nc(N)n3)cc2)cc1 |
| InChI | InChI=1S/C17H17N7O/c18-11-3-7-13(8-4-11)22-16(25)10-1-5-12(6-2-10)21-15-9-14(19)23-17(20)24-15/h1-9H,18H2,(H,22,25)(H5,19,20,21,23,24) |
| InChIKey | HISODLNPCUFFFO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|