C32H27N5O2 — CID 150367219
4-amino-N-[4-[3-amino-5-[4-[(4-aminobenzoyl)amino]phenyl]phenyl]phenyl]benzamide (PubChem CID 150367219) has the molecular formula C32H27N5O2 and a molecular weight of 513.60 g/mol. Its IUPAC name is 4-amino-N-[4-[3-amino-5-[4-[(4-aminobenzoyl)amino]phenyl]phenyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[4-[3-amino-5-[4-[(4-aminobenzoyl)amino]phenyl]phenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 150367219 |
| Molecular Formula | C32H27N5O2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 4-amino-N-[4-[3-amino-5-[4-[(4-aminobenzoyl)amino]phenyl]phenyl]phenyl]benzamide |
| SMILES | Nc1ccc(C(=O)Nc2ccc(-c3cc(N)cc(-c4ccc(NC(=O)c5ccc(N)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C32H27N5O2/c33-26-9-1-22(2-10-26)31(38)36-29-13-5-20(6-14-29)24-17-25(19-28(35)18-24)21-7-15-30(16-8-21)37-32(39)23-3-11-27(34)12-4-23/h1-19H,33-35H2,(H,36,38)(H,37,39) |
| InChIKey | GWYSZHRDRNIXIR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|