About N-(4-aminophenyl)benzamide;ethane;ethene
N-(4-aminophenyl)benzamide;ethane;ethene (PubChem CID 144544387) has the molecular formula C19H28N2O
and a molecular weight of 300.45 g/mol. Its IUPAC name is N-(4-aminophenyl)benzamide;ethane;ethene.
Molecular Properties
| Compound Name | N-(4-aminophenyl)benzamide;ethane;ethene |
| PubChem CID | 144544387 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-(4-aminophenyl)benzamide;ethane;ethene |
| SMILES | C=C.CC.CC.Nc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12N2O.2C2H6.C2H4/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10;3*1-2/h1-9H,14H2,(H,15,16);2*1-2H3;1-2H2 |
| InChIKey | PAUYGXCZRYXVNP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminophenyl)benzamide;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminophenyl)benzamide;ethane;ethene?
The IUPAC name of N-(4-aminophenyl)benzamide;ethane;ethene (CID 144544387) is N-(4-aminophenyl)benzamide;ethane;ethene.
What is the SMILES notation for N-(4-aminophenyl)benzamide;ethane;ethene?
The canonical SMILES for N-(4-aminophenyl)benzamide;ethane;ethene is C=C.CC.CC.Nc1ccc(NC(=O)c2ccccc2)cc1.
What is the InChIKey of N-(4-aminophenyl)benzamide;ethane;ethene?
The InChIKey is PAUYGXCZRYXVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O.2C2H6.C2H4/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10;3*1-2/h1-9H,14H2,(H,15,16);2*1-2H3;1-2H2.
What are the key properties of N-(4-aminophenyl)benzamide;ethane;ethene?
N-(4-aminophenyl)benzamide;ethane;ethene has a molecular weight of 300.45 g/mol, XLogP of 5.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminophenyl)benzamide;ethane;ethene is sourced from PubChem (CID 144544387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).