C31H36N8O — CID 161339761
4-amino-N-(4-aminophenyl)benzamide;aniline;4-(4,4-diaminocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-diene-1,1-diamine (PubChem CID 161339761) has the molecular formula C31H36N8O and a molecular weight of 536.68 g/mol. Its IUPAC name is 4-amino-N-(4-aminophenyl)benzamide;aniline;4-(4,4-diaminocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-diene-1,1-diamine.
| Compound Name | 4-amino-N-(4-aminophenyl)benzamide;aniline;4-(4,4-diaminocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-diene-1,1-diamine |
|---|---|
| PubChem CID | 161339761 |
| Molecular Formula | C31H36N8O |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 4-amino-N-(4-aminophenyl)benzamide;aniline;4-(4,4-diaminocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(=C2C=CC(N)(N)C=C2)C=C1.Nc1ccc(NC(=O)c2ccc(N)cc2)cc1.Nc1ccccc1 |
| InChI | InChI=1S/C13H13N3O.C12H16N4.C6H7N/c14-10-3-1-9(2-4-10)13(17)16-12-7-5-11(15)6-8-12;13-11(14)5-1-9(2-6-11)10-3-7-12(15,16)8-4-10;7-6-4-2-1-3-5-6/h1-8H,14-15H2,(H,16,17);1-8H,13-16H2;1-5H,7H2 |
| InChIKey | VMMZRTFSRXXAQF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 211.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|