C25H24N2O2 — CID 118096519
3-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-(3-methoxyphenyl)benzamide (PubChem CID 118096519) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-(3-methoxyphenyl)benzamide.
| Compound Name | 3-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 118096519 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2cccc(Cc3ccc4[nH]c(C)c(C)c4c3)c2)c1 |
| InChI | InChI=1S/C25H24N2O2/c1-16-17(2)26-24-11-10-19(14-23(16)24)12-18-6-4-7-20(13-18)25(28)27-21-8-5-9-22(15-21)29-3/h4-11,13-15,26H,12H2,1-3H3,(H,27,28) |
| InChIKey | SUPXGKPGODBKEK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|