C13H12N4O3S — CID 107642899
(E)-3-[5-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 107642899) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is (E)-3-[5-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107642899 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (E)-3-[5-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CCc1nnc(NC(=O)c2cncc(/C=C/C(=O)O)c2)s1 |
| InChI | InChI=1S/C13H12N4O3S/c1-2-10-16-17-13(21-10)15-12(20)9-5-8(6-14-7-9)3-4-11(18)19/h3-7H,2H2,1H3,(H,18,19)(H,15,17,20)/b4-3+ |
| InChIKey | DXILMMOZRNKXRF-ONEGZZNKSA-N |
| XLogP | 1.85 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|