C13H14N4O3S — CID 39147379
(E)-3-[1-[2-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]pyrrol-2-yl]prop-2-enoic acid (PubChem CID 39147379) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is (E)-3-[1-[2-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]pyrrol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[2-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]pyrrol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39147379 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (E)-3-[1-[2-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]pyrrol-2-yl]prop-2-enoic acid |
| SMILES | CCc1nnc(NC(=O)Cn2cccc2/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C13H14N4O3S/c1-2-11-15-16-13(21-11)14-10(18)8-17-7-3-4-9(17)5-6-12(19)20/h3-7H,2,8H2,1H3,(H,19,20)(H,14,16,18)/b6-5+ |
| InChIKey | BRFMNLOBEMHHJI-AATRIKPKSA-N |
| XLogP | 1.64 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|