C17H18N2O3 — CID 82030801
(E)-3-[1-[2-oxo-2-(2-phenylethylamino)ethyl]pyrrol-2-yl]prop-2-enoic acid (PubChem CID 82030801) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (E)-3-[1-[2-oxo-2-(2-phenylethylamino)ethyl]pyrrol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[2-oxo-2-(2-phenylethylamino)ethyl]pyrrol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82030801 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (E)-3-[1-[2-oxo-2-(2-phenylethylamino)ethyl]pyrrol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccn1CC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c20-16(18-11-10-14-5-2-1-3-6-14)13-19-12-4-7-15(19)8-9-17(21)22/h1-9,12H,10-11,13H2,(H,18,20)(H,21,22)/b9-8+ |
| InChIKey | UHJPPJMMLFUWOA-CMDGGOBGSA-N |
| XLogP | 1.94 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|