C24H25Cl2N3O2 — CID 127028743
N-[2-(3,4-dichlorophenyl)ethyl]-2-[2-oxo-3-(3-phenylpropylamino)-1-pyridinyl]acetamide (PubChem CID 127028743) has the molecular formula C24H25Cl2N3O2 and a molecular weight of 458.39 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)ethyl]-2-[2-oxo-3-(3-phenylpropylamino)-1-pyridinyl]acetamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)ethyl]-2-[2-oxo-3-(3-phenylpropylamino)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 127028743 |
| Molecular Formula | C24H25Cl2N3O2 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)ethyl]-2-[2-oxo-3-(3-phenylpropylamino)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cccc(NCCCc2ccccc2)c1=O)NCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H25Cl2N3O2/c25-20-11-10-19(16-21(20)26)12-14-28-23(30)17-29-15-5-9-22(24(29)31)27-13-4-8-18-6-2-1-3-7-18/h1-3,5-7,9-11,15-16,27H,4,8,12-14,17H2,(H,28,30) |
| InChIKey | MGNHSJBIYTXENG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|