C15H16N2O4 — CID 79323925
1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 79323925) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79323925 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(Cn1cccc1C(=O)O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C15H16N2O4/c18-12-5-3-11(4-6-12)7-8-16-14(19)10-17-9-1-2-13(17)15(20)21/h1-6,9,18H,7-8,10H2,(H,16,19)(H,20,21) |
| InChIKey | FMCLJUIHTGQCLT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |