C14H18N4O3 — CID 79324255
1-[2-(4-imidazol-1-ylbutylamino)-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 79324255) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-[2-(4-imidazol-1-ylbutylamino)-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-(4-imidazol-1-ylbutylamino)-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79324255 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[2-(4-imidazol-1-ylbutylamino)-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(Cn1cccc1C(=O)O)NCCCCn1ccnc1 |
| InChI | InChI=1S/C14H18N4O3/c19-13(10-18-8-3-4-12(18)14(20)21)16-5-1-2-7-17-9-6-15-11-17/h3-4,6,8-9,11H,1-2,5,7,10H2,(H,16,19)(H,20,21) |
| InChIKey | FDQCGWYYIGDKRW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|