C11H17N3O5S — CID 106341876
1-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 106341876) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is 1-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 106341876 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)Cn1cccc1C(=O)O |
| InChI | InChI=1S/C11H17N3O5S/c1-13(2)20(18,19)7-5-12-10(15)8-14-6-3-4-9(14)11(16)17/h3-4,6H,5,7-8H2,1-2H3,(H,12,15)(H,16,17) |
| InChIKey | MBPJYDJGDCXAFN-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |