C11H15N3O4 — CID 79324897
1-[2-[(4-amino-4-oxobutyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 79324897) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-[2-[(4-amino-4-oxobutyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-[(4-amino-4-oxobutyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79324897 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-[2-[(4-amino-4-oxobutyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | NC(=O)CCCNC(=O)Cn1cccc1C(=O)O |
| InChI | InChI=1S/C11H15N3O4/c12-9(15)4-1-5-13-10(16)7-14-6-2-3-8(14)11(17)18/h2-3,6H,1,4-5,7H2,(H2,12,15)(H,13,16)(H,17,18) |
| InChIKey | ZWMYLEPZHLNNBA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|