C13H13N3O3 — CID 79325398
1-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]pyrrole-2-carboxylic acid (PubChem CID 79325398) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79325398 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(Cn1cccc1C(=O)O)NCc1ccncc1 |
| InChI | InChI=1S/C13H13N3O3/c17-12(15-8-10-3-5-14-6-4-10)9-16-7-1-2-11(16)13(18)19/h1-7H,8-9H2,(H,15,17)(H,18,19) |
| InChIKey | OOHGQEOZEJCCGJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |