C16H20N4O2 — CID 110443115
N-[2-(4-imidazol-1-ylbutylamino)-2-oxoethyl]benzamide (PubChem CID 110443115) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[2-(4-imidazol-1-ylbutylamino)-2-oxoethyl]benzamide.
| Compound Name | N-[2-(4-imidazol-1-ylbutylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110443115 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[2-(4-imidazol-1-ylbutylamino)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NCCCCn1ccnc1 |
| InChI | InChI=1S/C16H20N4O2/c21-15(12-19-16(22)14-6-2-1-3-7-14)18-8-4-5-10-20-11-9-17-13-20/h1-3,6-7,9,11,13H,4-5,8,10,12H2,(H,18,21)(H,19,22) |
| InChIKey | KHWYQFZEYIVJIX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|