C12H10F3NO — CID 162340862
3-ethynyl-N,N-dimethyl-5-(trifluoromethyl)benzamide (PubChem CID 162340862) has the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. Its IUPAC name is 3-ethynyl-N,N-dimethyl-5-(trifluoromethyl)benzamide.
| Compound Name | 3-ethynyl-N,N-dimethyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162340862 |
| Molecular Formula | C12H10F3NO |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3-ethynyl-N,N-dimethyl-5-(trifluoromethyl)benzamide |
| SMILES | C#Cc1cc(C(=O)N(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F3NO/c1-4-8-5-9(11(17)16(2)3)7-10(6-8)12(13,14)15/h1,5-7H,2-3H3 |
| InChIKey | SELLDCBIJJIBCU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|