C21H16O4 — CID 22140273
3-[2-(3-carboxy-5-ethynylphenyl)propan-2-yl]-5-ethynylbenzoic acid (PubChem CID 22140273) has the molecular formula C21H16O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[2-(3-carboxy-5-ethynylphenyl)propan-2-yl]-5-ethynylbenzoic acid.
| Compound Name | 3-[2-(3-carboxy-5-ethynylphenyl)propan-2-yl]-5-ethynylbenzoic acid |
|---|---|
| PubChem CID | 22140273 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-[2-(3-carboxy-5-ethynylphenyl)propan-2-yl]-5-ethynylbenzoic acid |
| SMILES | C#Cc1cc(C(=O)O)cc(C(C)(C)c2cc(C#C)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C21H16O4/c1-5-13-7-15(19(22)23)11-17(9-13)21(3,4)18-10-14(6-2)8-16(12-18)20(24)25/h1-2,7-12H,3-4H3,(H,22,23)(H,24,25) |
| InChIKey | WELUKMVAFPYDKO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|