C19H12N2O5 — CID 59499557
5-[(3,5-diethynylphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid (PubChem CID 59499557) has the molecular formula C19H12N2O5 and a molecular weight of 348.31 g/mol. Its IUPAC name is 5-[(3,5-diethynylphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(3,5-diethynylphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59499557 |
| Molecular Formula | C19H12N2O5 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 5-[(3,5-diethynylphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid |
| SMILES | C#Cc1cc(C#C)cc(NC(=O)Nc2cc(C(=O)O)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C19H12N2O5/c1-3-11-5-12(4-2)7-15(6-11)20-19(26)21-16-9-13(17(22)23)8-14(10-16)18(24)25/h1-2,5-10H,(H,22,23)(H,24,25)(H2,20,21,26) |
| InChIKey | GZTHFMJPKYIEGZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|