C19H16N2O5 — CID 59499610
dimethyl 5-[(4-ethynylphenyl)carbamoylamino]benzene-1,3-dicarboxylate (PubChem CID 59499610) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is dimethyl 5-[(4-ethynylphenyl)carbamoylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(4-ethynylphenyl)carbamoylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59499610 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | dimethyl 5-[(4-ethynylphenyl)carbamoylamino]benzene-1,3-dicarboxylate |
| SMILES | C#Cc1ccc(NC(=O)Nc2cc(C(=O)OC)cc(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C19H16N2O5/c1-4-12-5-7-15(8-6-12)20-19(24)21-16-10-13(17(22)25-2)9-14(11-16)18(23)26-3/h1,5-11H,2-3H3,(H2,20,21,24) |
| InChIKey | BGFPOXXLGDOXNO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|