C17H10F5NO5 — CID 2169568
dimethyl 5-[(2,3,4,5,6-pentafluorobenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 2169568) has the molecular formula C17H10F5NO5 and a molecular weight of 403.26 g/mol. Its IUPAC name is dimethyl 5-[(2,3,4,5,6-pentafluorobenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2,3,4,5,6-pentafluorobenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2169568 |
| Molecular Formula | C17H10F5NO5 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | dimethyl 5-[(2,3,4,5,6-pentafluorobenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2c(F)c(F)c(F)c(F)c2F)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H10F5NO5/c1-27-16(25)6-3-7(17(26)28-2)5-8(4-6)23-15(24)9-10(18)12(20)14(22)13(21)11(9)19/h3-5H,1-2H3,(H,23,24) |
| InChIKey | ZXZHEOQKBGLSEO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|