C17H14FNO5 — CID 875384
dimethyl 5-[(3-fluorobenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 875384) has the molecular formula C17H14FNO5 and a molecular weight of 331.30 g/mol. Its IUPAC name is dimethyl 5-[(3-fluorobenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(3-fluorobenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 875384 |
| Molecular Formula | C17H14FNO5 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | dimethyl 5-[(3-fluorobenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2cccc(F)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H14FNO5/c1-23-16(21)11-6-12(17(22)24-2)9-14(8-11)19-15(20)10-4-3-5-13(18)7-10/h3-9H,1-2H3,(H,19,20) |
| InChIKey | BLCQUUOCKZMHSV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |