C11H11N3O6 — CID 61187988
5-[(2-amino-2-oxoethyl)carbamoylamino]benzene-1,3-dicarboxylic acid (PubChem CID 61187988) has the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. Its IUPAC name is 5-[(2-amino-2-oxoethyl)carbamoylamino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(2-amino-2-oxoethyl)carbamoylamino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 61187988 |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 5-[(2-amino-2-oxoethyl)carbamoylamino]benzene-1,3-dicarboxylic acid |
| SMILES | NC(=O)CNC(=O)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C11H11N3O6/c12-8(15)4-13-11(20)14-7-2-5(9(16)17)1-6(3-7)10(18)19/h1-3H,4H2,(H2,12,15)(H,16,17)(H,18,19)(H2,13,14,20) |
| InChIKey | SRLUMZGKQSCMRB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |