C14H14N2O5 — CID 106232282
5-(pent-1-yn-3-ylcarbamoylamino)benzene-1,3-dicarboxylic acid (PubChem CID 106232282) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-(pent-1-yn-3-ylcarbamoylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(pent-1-yn-3-ylcarbamoylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 106232282 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-(pent-1-yn-3-ylcarbamoylamino)benzene-1,3-dicarboxylic acid |
| SMILES | C#CC(CC)NC(=O)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C14H14N2O5/c1-3-10(4-2)15-14(21)16-11-6-8(12(17)18)5-9(7-11)13(19)20/h1,5-7,10H,4H2,2H3,(H,17,18)(H,19,20)(H2,15,16,21) |
| InChIKey | LLSNPBSGTXUCAW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|