C13H13ClN2O3 — CID 106232020
4-chloro-2-(pent-1-yn-3-ylcarbamoylamino)benzoic acid (PubChem CID 106232020) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 4-chloro-2-(pent-1-yn-3-ylcarbamoylamino)benzoic acid.
| Compound Name | 4-chloro-2-(pent-1-yn-3-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 106232020 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 4-chloro-2-(pent-1-yn-3-ylcarbamoylamino)benzoic acid |
| SMILES | C#CC(CC)NC(=O)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C13H13ClN2O3/c1-3-9(4-2)15-13(19)16-11-7-8(14)5-6-10(11)12(17)18/h1,5-7,9H,4H2,2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | GIEXUGVEXDAVMH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|