C14H16F6N2O — CID 108888360
1-[3,5-bis(trifluoromethyl)phenyl]-3-pentan-3-ylurea (PubChem CID 108888360) has the molecular formula C14H16F6N2O and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-pentan-3-ylurea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 108888360 |
| Molecular Formula | C14H16F6N2O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F6N2O/c1-3-10(4-2)21-12(23)22-11-6-8(13(15,16)17)5-9(7-11)14(18,19)20/h5-7,10H,3-4H2,1-2H3,(H2,21,22,23) |
| InChIKey | SCSOJEHQJPIJTJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |