C15H18F6N2O — CID 127585442
3-[3,5-bis(trifluoromethyl)phenyl]-1,1-dipropylurea (PubChem CID 127585442) has the molecular formula C15H18F6N2O and a molecular weight of 356.31 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-1,1-dipropylurea.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 127585442 |
| Molecular Formula | C15H18F6N2O |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F6N2O/c1-3-5-23(6-4-2)13(24)22-12-8-10(14(16,17)18)7-11(9-12)15(19,20)21/h7-9H,3-6H2,1-2H3,(H,22,24) |
| InChIKey | XDHBVEKYKAXUTE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |