C11H9F6NOS2 — CID 141085999
N-[3,5-bis(trifluoromethyl)phenyl]-2-(methyldisulfanyl)acetamide (PubChem CID 141085999) has the molecular formula C11H9F6NOS2 and a molecular weight of 349.32 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-(methyldisulfanyl)acetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(methyldisulfanyl)acetamide |
|---|---|
| PubChem CID | 141085999 |
| Molecular Formula | C11H9F6NOS2 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(methyldisulfanyl)acetamide |
| SMILES | CSSCC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F6NOS2/c1-20-21-5-9(19)18-8-3-6(10(12,13)14)2-7(4-8)11(15,16)17/h2-4H,5H2,1H3,(H,18,19) |
| InChIKey | JLMSEAKTSJPDSH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|