C12H12F6N2OS — CID 84552453
2-(2-aminoethylsulfanyl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 84552453) has the molecular formula C12H12F6N2OS and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 84552453 |
| Molecular Formula | C12H12F6N2OS |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | NCCSCC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6N2OS/c13-11(14,15)7-3-8(12(16,17)18)5-9(4-7)20-10(21)6-22-2-1-19/h3-5H,1-2,6,19H2,(H,20,21) |
| InChIKey | QXCICZOYSFZOJR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|