C12H11F6NO3S — CID 127504659
N-[3,5-bis(trifluoromethyl)phenyl]-3-methylsulfonylpropanamide (PubChem CID 127504659) has the molecular formula C12H11F6NO3S and a molecular weight of 363.28 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 127504659 |
| Molecular Formula | C12H11F6NO3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-3-methylsulfonylpropanamide |
| SMILES | CS(=O)(=O)CCC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO3S/c1-23(21,22)3-2-10(20)19-9-5-7(11(13,14)15)4-8(6-9)12(16,17)18/h4-6H,2-3H2,1H3,(H,19,20) |
| InChIKey | XRLQXBVMMODLFY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |