C15H20F3N3O3S — CID 110343225
3-(4-methylpiperazin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 110343225) has the molecular formula C15H20F3N3O3S and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(4-methylpiperazin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 110343225 |
| Molecular Formula | C15H20F3N3O3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CN1CCN(S(=O)(=O)CCC(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H20F3N3O3S/c1-20-6-8-21(9-7-20)25(23,24)10-5-14(22)19-13-4-2-3-12(11-13)15(16,17)18/h2-4,11H,5-10H2,1H3,(H,19,22) |
| InChIKey | IVEIMKHZDPKIIA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |