C20H21F3N4O5S — CID 15993096
3-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 15993096) has the molecular formula C20H21F3N4O5S and a molecular weight of 486.47 g/mol. Its IUPAC name is 3-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 15993096 |
| Molecular Formula | C20H21F3N4O5S |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 3-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N4O5S/c21-20(22,23)15-3-1-4-16(13-15)24-19(28)7-8-25-9-11-26(12-10-25)33(31,32)18-6-2-5-17(14-18)27(29)30/h1-6,13-14H,7-12H2,(H,24,28) |
| InChIKey | BPKBFAGXXFDEEA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|