C26H26F3N3O5S — CID 46102551
1-(3-nitrophenyl)sulfonyl-4-[2-[phenyl-[3-(trifluoromethyl)phenyl]methoxy]ethyl]piperazine (PubChem CID 46102551) has the molecular formula C26H26F3N3O5S and a molecular weight of 549.57 g/mol. Its IUPAC name is 1-(3-nitrophenyl)sulfonyl-4-[2-[phenyl-[3-(trifluoromethyl)phenyl]methoxy]ethyl]piperazine.
| Compound Name | 1-(3-nitrophenyl)sulfonyl-4-[2-[phenyl-[3-(trifluoromethyl)phenyl]methoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 46102551 |
| Molecular Formula | C26H26F3N3O5S |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 1-(3-nitrophenyl)sulfonyl-4-[2-[phenyl-[3-(trifluoromethyl)phenyl]methoxy]ethyl]piperazine |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCN(CCOC(c3ccccc3)c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C26H26F3N3O5S/c27-26(28,29)22-9-4-8-21(18-22)25(20-6-2-1-3-7-20)37-17-16-30-12-14-31(15-13-30)38(35,36)24-11-5-10-23(19-24)32(33)34/h1-11,18-19,25H,12-17H2 |
| InChIKey | OOXSGUDHYQJYNG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|