C27H25F6N3O2 — CID 98404773
4-[2-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methoxy]ethyl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 98404773) has the molecular formula C27H25F6N3O2 and a molecular weight of 537.50 g/mol. Its IUPAC name is 4-[2-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methoxy]ethyl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methoxy]ethyl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 98404773 |
| Molecular Formula | C27H25F6N3O2 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 4-[2-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methoxy]ethyl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)N1CCN(CCO[C@@H](c2ccccc2)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H25F6N3O2/c28-21-9-10-22(24(30)23(21)29)34-26(37)36-13-11-35(12-14-36)15-16-38-25(18-5-2-1-3-6-18)19-7-4-8-20(17-19)27(31,32)33/h1-10,17,25H,11-16H2,(H,34,37)/t25-/m0/s1 |
| InChIKey | HZEGPLKKQDBNCX-VWLOTQADSA-N |
| XLogP | 6.08 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|