C26H28F2N2O4S — CID 46102619
1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-methoxyphenyl)sulfonylpiperazine (PubChem CID 46102619) has the molecular formula C26H28F2N2O4S and a molecular weight of 502.58 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-methoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-methoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 46102619 |
| Molecular Formula | C26H28F2N2O4S |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-methoxyphenyl)sulfonylpiperazine |
| SMILES | COc1cccc(S(=O)(=O)N2CCN(CCOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C26H28F2N2O4S/c1-33-24-3-2-4-25(19-24)35(31,32)30-15-13-29(14-16-30)17-18-34-26(20-5-9-22(27)10-6-20)21-7-11-23(28)12-8-21/h2-12,19,26H,13-18H2,1H3 |
| InChIKey | FGUQUXGHNVOOPD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |