C18H18F6N4O — CID 108787887
N-[3,5-bis(trifluoromethyl)phenyl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]butanamide (PubChem CID 108787887) has the molecular formula C18H18F6N4O and a molecular weight of 420.36 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]butanamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]butanamide |
|---|---|
| PubChem CID | 108787887 |
| Molecular Formula | C18H18F6N4O |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]butanamide |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H18F6N4O/c1-10-6-11(2)27-16(26-10)25-5-3-4-15(29)28-14-8-12(17(19,20)21)7-13(9-14)18(22,23)24/h6-9H,3-5H2,1-2H3,(H,28,29)(H,25,26,27) |
| InChIKey | POMKMBHOZSZCCZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|