C17H20N4O4 — CID 108800780
4-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoylamino]-3-hydroxybenzoic acid (PubChem CID 108800780) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoylamino]-3-hydroxybenzoic acid.
| Compound Name | 4-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoylamino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108800780 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoylamino]-3-hydroxybenzoic acid |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2ccc(C(=O)O)cc2O)n1 |
| InChI | InChI=1S/C17H20N4O4/c1-10-8-11(2)20-17(19-10)18-7-3-4-15(23)21-13-6-5-12(16(24)25)9-14(13)22/h5-6,8-9,22H,3-4,7H2,1-2H3,(H,21,23)(H,24,25)(H,18,19,20) |
| InChIKey | AALDLCUVEBPYDN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|