C20H27N5O3S — CID 108800741
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)butanamide (PubChem CID 108800741) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 108800741 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)butanamide |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C20H27N5O3S/c1-15-14-16(2)23-20(22-15)21-11-5-6-19(26)24-17-7-9-18(10-8-17)29(27,28)25-12-3-4-13-25/h7-10,14H,3-6,11-13H2,1-2H3,(H,24,26)(H,21,22,23) |
| InChIKey | FXXPKHULPJHOMV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|