C19H18F6N2O3S — CID 28557405
N-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(dimethylsulfamoyl)phenyl]propanamide (PubChem CID 28557405) has the molecular formula C19H18F6N2O3S and a molecular weight of 468.42 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(dimethylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(dimethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 28557405 |
| Molecular Formula | C19H18F6N2O3S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(dimethylsulfamoyl)phenyl]propanamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CCC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H18F6N2O3S/c1-27(2)31(29,30)16-6-3-12(4-7-16)5-8-17(28)26-15-10-13(18(20,21)22)9-14(11-15)19(23,24)25/h3-4,6-7,9-11H,5,8H2,1-2H3,(H,26,28) |
| InChIKey | KLMSWTZXKPTCCR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |