C18H16F6N2O4S — CID 28554728
N-[3,5-bis(trifluoromethyl)phenyl]-2-[4-(dimethylsulfamoyl)phenoxy]acetamide (PubChem CID 28554728) has the molecular formula C18H16F6N2O4S and a molecular weight of 470.39 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-[4-(dimethylsulfamoyl)phenoxy]acetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[4-(dimethylsulfamoyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 28554728 |
| Molecular Formula | C18H16F6N2O4S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[4-(dimethylsulfamoyl)phenoxy]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H16F6N2O4S/c1-26(2)31(28,29)15-5-3-14(4-6-15)30-10-16(27)25-13-8-11(17(19,20)21)7-12(9-13)18(22,23)24/h3-9H,10H2,1-2H3,(H,25,27) |
| InChIKey | APUAWNZNYALEJM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |